BMMCBZ4Sk005
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 552-14-7 |
KEGG | C03986 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ4Sk005.mol |
Structural Information | |
---|---|
Systematic Name | 3-Hydroxy-4-methyl-anthranilic acid |
Common Name | |
Symbol | |
Formula | C8H9NO3 |
Exact Mass | 167.0582 |
Average Mass | 167.162 |
SMILES | Cc(c1)c(O)c(N)c(c1)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways