BMMCACDEk007
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=cis-3-(1-Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol | + | |SysName=cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol |
− | |Common Name=&&cis-3-(1-Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol&& | + | |Common Name=&&cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol&& |
|CAS=? | |CAS=? | ||
|KEGG=C11456 | |KEGG=C11456 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C11456 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACDEk007.mol |
cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol | |
---|---|
Structural Information | |
Systematic Name | cis-3- (1-Carboxy-ethyl) -3,5-cyclo-hexadiene-1,2-diol |
Common Name |
|
Symbol | |
Formula | C9H12O4 |
Exact Mass | 184.0735 |
Average Mass | 184.1891 |
SMILES | OC(=O)C(C)C(=C1)C(O)C(O)C=C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |