BMMCACCHk006
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C04670 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACCHk006.mol |
(1S,4S)-4-Hydroxy-3-oxocyclohexane-1-carboxylate | |
---|---|
Structural Information | |
Systematic Name | (1S,4S)-4-Hydroxy-3-oxo-cyclohexane-1-carboxylic acid |
Common Name |
|
Symbol | |
Formula | C7H10O4 |
Exact Mass | 158.0579 |
Average Mass | 158.1519 |
SMILES | OC(=O)[C@@H](C1)CC(=O)[C@@H](O)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways