BMFYS3CAf003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-3-Sulfo-lactic acid | + | |SysName= (S) -3-Sulfo-lactic acid |
| − | |Common Name=&&(S)-3-Sulfolactate&& | + | |Common Name=&& (S) -3-Sulfolactate&& |
|CAS=? | |CAS=? | ||
|KEGG=C11499 | |KEGG=C11499 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C11499 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYS3CAf003.mol |
| (S) -3-Sulfolactate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -3-Sulfo-lactic acid |
| Common Name |
|
| Symbol | |
| Formula | C3H6O6S |
| Exact Mass | 169.9885 |
| Average Mass | 170.1421 |
| SMILES | O[C@H](C(O)=O)CS(O)(=O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
