BMCCPUXA0025
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=XTP | |SysName=XTP | ||
|Common Name=&&XTP&& | |Common Name=&&XTP&& | ||
| − | |CAS= | + | |CAS=6253-56-1 |
|KEGG=C00700 | |KEGG=C00700 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6253-56-1 |
| KEGG | C00700 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUXA0025.mol |
| XTP | |
|---|---|
| |
| Structural Information | |
| Systematic Name | XTP |
| Common Name |
|
| Symbol | |
| Formula | C10H15N4O15P3 |
| Exact Mass | 523.9746 |
| Average Mass | 524.1653 |
| SMILES | O=C(N3)Nc(c2C(=O)3)n(cn2)[C@H](O1)[C@H](O)[C@H](O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- [ [ [ [(2R,3S,4R,5R) -5- (2,6-Dioxo-3H-purin-9-yl) -3,4-dihydroxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] [(2R,3S,4R,5R) -5- (2,6-dioxo-3H-purin-9-yl) -3,4-dihydroxyoxolan-2-yl] methyl hydrogen phosphate ⇔ this
- this ⇔ XMP
