BMCCPUXA0023
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=XDP | |SysName=XDP | ||
|Common Name=&&XDP&& | |Common Name=&&XDP&& | ||
| − | |CAS= | + | |CAS=29042-61-3 |
|KEGG=C01337 | |KEGG=C01337 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 29042-61-3 |
| KEGG | C01337 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUXA0023.mol |
| XDP | |
|---|---|
| |
| Structural Information | |
| Systematic Name | XDP |
| Common Name |
|
| Symbol | |
| Formula | C10H14N4O12P2 |
| Exact Mass | 444.0083 |
| Average Mass | 444.1854 |
| SMILES | O=C(N3)Nc(c2C(=O)3)n(cn2)[C@H](O1)[C@H](O)[C@H](O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
