BMCCID--l017
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 2208-41-5 |
KEGG | C05643 |
KNApSAcK | |
CDX file | |
MOL file | BMCCID--l017.mol |
6-Hydroxymelatonin | |
---|---|
Structural Information | |
Systematic Name | 6-Hydroxy-melatonin |
Common Name |
|
Symbol | |
Formula | C13H16N2O3 |
Exact Mass | 248.116 |
Average Mass | 248.2778 |
SMILES | COc(c1)c(O)cc(n2)c1c(CCNC(C)=O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways