BMCCCC--0028
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 2447-54-3 |
KEGG | C06162 |
KNApSAcK | |
CDX file | |
MOL file | BMCCCC--0028.mol |
Sanguinarine | |
---|---|
Structural Information | |
Systematic Name | Sanguinarine |
Common Name |
|
Symbol | |
Formula | C20H14NO4 |
Exact Mass | 332.0922 |
Average Mass | 332.3295 |
SMILES | c(c36)(c(ccc3c(c5c[n+1]6C)cc(c4c5)OCO4)2)cc(c1c2)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |