BMAXS5ANk005
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06655 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS5ANk005.mol |
L-N2- (2-Carboxyethyl) arginine | |
---|---|
Structural Information | |
Systematic Name | N2- (2-Carboxy-ethyl) -arginine |
Common Name |
|
Symbol | |
Formula | C9H18N4O4 |
Exact Mass | 246.1328 |
Average Mass | 246.2637 |
SMILES | NC(=N)NCCC[C@H](NCCC(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways