BMAXS2AKt002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C05832 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS2AKt002.mol |
5-Hydroxyindoleacetylglycine | |
---|---|
Structural Information | |
Systematic Name | 5-Hydroxy-indole-acetylglycine |
Common Name |
|
Symbol | |
Formula | C12H12N2O4 |
Exact Mass | 248.0797 |
Average Mass | 248.2347 |
SMILES | OC(=O)CNC(=O)Cc(c1)c(c2)c(ccc(O)2)n1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways