BMACBZHLt008
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 51-48-9 |
KEGG | C01829 |
KNApSAcK | |
CDX file | |
MOL file | BMACBZHLt008.mol |
O-(4-Hydroxy-3,5-diidophenyl)-3,5-diiodo-L-tyrosine | |
---|---|
Structural Information | |
Systematic Name | L-Thyroxine |
Common Name |
|
Symbol | |
Formula | C15H11I4NO4 |
Exact Mass | 776.6866 |
Average Mass | 776.8712 |
SMILES | OC(=O)[C@@H](N)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c(I)2)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways