BMACBZHLt008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=L-Thyroxine | |SysName=L-Thyroxine | ||
| − | |Common Name=&&O-(4-Hydroxy-3,5-diidophenyl)-3,5-diiodo-L-tyrosine&&L-Thyroxine&&3,5,3'5'-Tetraiodo-L-thyronine&& | + | |Common Name=&&O- (4-Hydroxy-3,5-diidophenyl) -3,5-diiodo-L-tyrosine&&L-Thyroxine&&3,5,3'5'-Tetraiodo-L-thyronine&& |
|CAS=51-48-9 | |CAS=51-48-9 | ||
|KEGG=C01829 | |KEGG=C01829 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 51-48-9 |
| KEGG | C01829 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMACBZHLt008.mol |
| O- (4-Hydroxy-3,5-diidophenyl) -3,5-diiodo-L-tyrosine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-Thyroxine |
| Common Name |
|
| Symbol | |
| Formula | C15H11I4NO4 |
| Exact Mass | 776.6866 |
| Average Mass | 776.8712 |
| SMILES | OC(=O)[C@@H](N)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c(I)2)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
