BMAAS5CAq004
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
|SysName=L-erythro-4-Hydroxy-glutamic acid | |SysName=L-erythro-4-Hydroxy-glutamic acid | ||
|Common Name=&&L-erythro-4-Hydroxyglutamate&& | |Common Name=&&L-erythro-4-Hydroxyglutamate&& | ||
| − | |CAS= | + | |CAS=2485-33-8 |
|KEGG=C05947 | |KEGG=C05947 | ||
}} | }} | ||
Revision as of 09:00, 14 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2485-33-8 |
| KEGG | C05947 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAAS5CAq004.mol |
| L-erythro-4-Hydroxyglutamate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | L-erythro-4-Hydroxy-glutamic acid |
| Common Name |
|
| Symbol | |
| Formula | C5H9NO5 |
| Exact Mass | 163.048 |
| Average Mass | 163.1286 |
| SMILES | N[C@@H](C[C@@H](O)C(O)=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- (2S,4R) -2-Amino-4-hydroxy-5-oxopentanoic ⇔ this
- this ⇔ D-Glutamic acid
- this ⇔ (2S) -2-Amino-pentanedioic acid
- this ⇔ D-4-Hydroxy-2-oxo-glutaric acid
- (2S,4R) -4-Hydroxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid ⇔ this
