LBF18205SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0166 |
| LipidMaps | LMFA01030127 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18205SC01.mol |
| |
| Structural Information | |
| Systematic Name | cis-10, cis-13-Octadecadienoic acid |
| Common Name | |
| Symbol | |
| Formula | C18H32O2 |
| Exact Mass | 280.240230268 |
| Average Mass | 280.44548000000003 |
| SMILES | CCCCC=CCC=CCCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | -9°C to -6.5°C |
| Boiling Point | 121°C to 128°C at 0.0001mmHg |
| Density | |
| Optical Rotation | 1.4670 at 25°C |
| Reflactive Index | |
| Solubility | <<0194>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
