LBF18109HO01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0374 |
| LipidMaps | LMFA01050108 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18109HO01.mol |
| Ricinoleic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 12-Hydroxy-cis-9-octadecenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H34O3 |
| Exact Mass | 298.25079495399996 |
| Average Mass | 298.46076 |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 5.0, 7.7 and 16.0°C (trimorphic) |
| Boiling Point | 225°C at 10 mm Hg |
| Density | d27.440.940 |
| Optical Rotation | 1.4716 at 20°C |
| Reflactive Index | |
| Solubility | soluble in acetone, ethanol, ether ; slightly soluble in chloroform ; insoluble in water. <<0148>>/<<0197>>/<<0228>>/<<0284>>/<<0345>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
