FLID2GNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLID Pterocarpane : FLID2G 2,3,8,9,10-Pentahydroxypterocarpane and O-methyl derivatives (0 pages) : FLID2GNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76474-66-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID2GNS0001.mol |
| 2,8-Dihydroxy-3,9,10-trimethoxypterocarpan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,8-Dihydroxy-3,9,10-trimethoxypterocarpan |
| Common Name |
|
| Symbol | |
| Formula | C18H18O7 |
| Exact Mass | 346.10525293 |
| Average Mass | 346.33132 |
| SMILES | c(c1O)c(C24)c(OC(c(c(OC4)3)cc(O)c(OC)c3)2)c(c1OC)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
