FLIA1LNP0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (28 pages) : FLIA1LNP Pyranoflavonoid (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 7731-08-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA1LNP0004.mol |
| Ferrugone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (2,5-Dimethoxy-3,4-methylenedioxyphenyl) -8,8-dimethyl-4H,8H-benzo [ 1,2-b:3,4-b' ] dipyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C23H20O7 |
| Exact Mass | 408.120902994 |
| Average Mass | 408.40070000000003 |
| SMILES | O(C=3)c(c(C(C3c(c5OC)cc(OC)c(c54)OCO4)=O)2)c(C=1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
