FL3FFAGS0013
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FFA Isoscutellarein and O-methyl derivatives (34 pages) : FL3FFAGS O-Glycoside (22 pages) : FL3FFAGS0 Normal (17 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 175923-47-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FFAGS0013.mol |
| 8-Hydroxyapigenin 7-glucosyl- (1->2) -xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- [ (2-O-beta-D-Glucopyranosyl-beta-D-xylopyranosyl) oxy ] -5,8-dihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C26H28O15 |
| Exact Mass | 580.1428202259999 |
| Average Mass | 580.49152 |
| SMILES | C(C4O)(O)C(OC(C(O)5)OC(C(O)C5O)CO)C(OC4)Oc(c(O)1)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
