FL2FGGNS0001
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FGG 5,6,7,8,3',4',5'-Heptahydroxyflavanone and O-methyl derivatives (1 pages) : FL2FGGNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 77053-47-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FGGNS0001.mol | 
| Agecorynin B | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 5,6,7,8,3'-Pentamethoxy-4',5'-methylenedioxyflavanone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H22O9 | 
| Exact Mass | 418.126382302 | 
| Average Mass | 418.39398 | 
| SMILES |  COc(c12)cc(C(O4)CC(c(c43)c(OC)c(c(c(OC)3)OC)OC)=O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
