FL2FA9NS0008
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FA9 5,7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (90 pages) : FL2FA9NS Simple substitution (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 153653-38-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NS0008.mol |
| Pinocembrin 7-O-benzoate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxyflavanone 7-O-benzoate |
| Common Name |
|
| Symbol | |
| Formula | C22H16O5 |
| Exact Mass | 360.099773622 |
| Average Mass | 360.35944000000006 |
| SMILES | C(O2)(CC(c(c4O)c(cc(c4)OC(c(c3)cccc3)=O)2)=O)c(c1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
