FL1CHYNS0009
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CHY beta-Hydroxychalcone (36 pages) : FL1CHYNS Simple substitution (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 142608-96-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNS0009.mol |
| Ponganone X | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4-Methylenedioxy-2',4',6'-trimethoxy-beta-hydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(c32)(OCO3)ccc(c2)C(O)=CC(c(c(OC)1)c(OC)cc(OC)c1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
