FL4DFANS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DFA 8-Hydroxyaromadendrin and O-methyl derivatives (6 pages) : FL4DFANS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 111514-42-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DFANS0002.mol |
| 3,5,7-Trihydroxy-8,4'-dimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-8,4'-dimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O7 |
| Exact Mass | 332.089602866 |
| Average Mass | 332.30474 |
| SMILES | COc(c3)ccc(c3)C(O1)C(O)C(=O)c(c(O)2)c1c(OC)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
