FL3FF8GS0011
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 245472-32-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FF8GS0011.mol |
| Skullcapflavone I 2'- (2"-E-cinnamoylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-7,8-dimethoxy-2- [ 2- [ [ 2-O- [ (2E) -1-oxo-3-phenyl-2-propenyl ] -beta-D-glucopyranosyl ] oxy ] phenyl ] -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C32H30O12 |
| Exact Mass | 606.173726424 |
| Average Mass | 606.5734 |
| SMILES | c(c(OC(C4OC(=O)C=Cc(c5)cccc5)OC(CO)C(O)C4O)1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
