FL3F2GNS0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F2G 6,7,3',4',5'-Pentahydroxyflavone and O-methyl derivatives (3 pages) : FL3F2GNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 177602-71-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F2GNS0004.mol |
| 6,7,4'-Trihydroxy-3',5'-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7-Dihydroxy-2- (4-hydroxy-3,5-dimethoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c1)c(O)c(OC)cc1C(=C2)Oc(c3)c(cc(O)c(O)3)C(=O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
