FL1CACNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CAC 3,4,2',4',6'-Pentahydroxychalcone (5 pages) : FL1CACNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14917-41-0,73692-51-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CACNS0001.mol |
| 3,4,2',4',6'-Pentahydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4,2',4',6'-Pentahydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c1)cc(O)c(C(=O)C=Cc(c2)cc(O)c(O)c2)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
