FL1CA8NS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CA8 2,(3),(5),(6),2',4',6'-Hydroxychalcone (7 pages) : FL1CA8NS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 118267-80-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA8NS0002.mol |
| 2'-Hydroxy-2,4',6'-trimethoxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2'-Hydroxy-2,4',6'-trimethoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H18O5 |
| Exact Mass | 314.115423686 |
| Average Mass | 314.33252 |
| SMILES | c(c1C(=O)C=Cc(c2)c(OC)ccc2)(O)cc(OC)cc1OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
