FL1AA9NF0001
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1AA9 4,6,(3'),(5')-Hydroxyaurone O-methyl derivatives (1 pages) : FL1AA9NF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 61755-72-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1AA9NF0001.mol | 
| 4-Hydroxyfurano [ 2",3":6,7 ] aurone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 4-Hydroxyfurano [ 2",3":6,7 ] aurone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C17H10O4 | 
| Exact Mass | 278.057908808 | 
| Average Mass | 278.2589 | 
| SMILES | c(c4)ccc(c4)C=c(o1)c(=O)c(c(O)2)c1c(c3)c(oc3)c2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
