BMMCPYUR0016
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 58-97-9 |
| KEGG | C00105 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCPYUR0016.mol |
| UMP | |
|---|---|
| |
| Structural Information | |
| Systematic Name | UMP |
| Common Name |
|
| Symbol | |
| Formula | C9H13N2O9P |
| Exact Mass | 324.0358 |
| Average Mass | 324.1813 |
| SMILES | O=C(C=2)NC(=O)N(C2)[C@H](O1)[C@H](O)[C@H](O)[C@@H] |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
- [ [ [ [(2R,3S,4R,5R) -5- (2,4-Dioxopyrimidin-1-yl) -3,4-dihydroxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] [(2R,3S,4R,5R) -5- (2,4-dioxopyrimidin-1-yl) -3,4-dihydroxyoxolan-2-yl] methyl hydrogen phosphate ⇔ this
- this ⇔ UDP
- this ⇔ 1H-Pyrimidine-2,4-dione
- this ⇔ D-5-Phospho-ribosyl 1-diphosphate
- 1- [3,4-Dihydroxy-5- (hydroxymethyl) oxolan-2-yl] pyrimidine-2,4-dione ⇔ this
- UTP ⇔ this
- UDP-2,3-bis(3-hydroxy-tetradecanoyl)-glucosamine ⇔ this
- UDP-N-acetyl-D-glucosamine ⇔ this
- 5'-Orotidylic acid ⇔ this
