BMMCPD--e032
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 447-05-2 |
KEGG | C00627 |
KNApSAcK | |
CDX file | |
MOL file | BMMCPD--e032.mol |
Pyridoxine phosphate | |
---|---|
Structural Information | |
Systematic Name | Pyridoxine 5'-phosphate |
Common Name |
|
Symbol | |
Formula | C8H12NO6P |
Exact Mass | 249.0402 |
Average Mass | 249.1577 |
SMILES | OCc(c(O)1)c(cnc(C)1)COP(O)(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways