BMMCLA--k006
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 13249-46-2 |
KEGG | C01278 |
KNApSAcK | |
CDX file | |
MOL file | BMMCLA--k006.mol |
Structural Information | |
---|---|
Systematic Name | 4-Carboxy-muconolactone |
Common Name | |
Symbol | |
Formula | C7H6O6 |
Exact Mass | 186.0164 |
Average Mass | 186.1189 |
SMILES | OC(=O)CC(C=1)(OC(=O)C1)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways