BMMCBZ2Oe004
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 5962-18-5 |
| KEGG | C01302 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCBZ2Oe004.mol |
| |
| Structural Information | |
| Systematic Name | 1- (2-Carboxy-phenyl-amino) -1-deoxy-D-ribulose 5-phosphate |
| Common Name | |
| Symbol | |
| Formula | C12H16NO9P |
| Exact Mass | 349.0562 |
| Average Mass | 349.2305 |
| SMILES | OC(=O)c(c1)c(ccc1)NCC(=O)[C@H](O)[C@H](O)COP(O)(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
