BMMCBZ2Oe004
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 5962-18-5 |
KEGG | C01302 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ2Oe004.mol |
Structural Information | |
---|---|
Systematic Name | 1- (2-Carboxy-phenyl-amino) -1-deoxy-D-ribulose 5-phosphate |
Common Name | |
Symbol | |
Formula | C12H16NO9P |
Exact Mass | 349.0562 |
Average Mass | 349.2305 |
SMILES | OC(=O)c(c1)c(ccc1)NCC(=O)[C@H](O)[C@H](O)COP(O)(O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways