BMMCAS--d008
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03832 |
KNApSAcK | |
CDX file | |
MOL file | BMMCAS--d008.mol |
3,5,3'-Triiodothyropyruvate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3,5,3'-Triiodo-thyro-pyruvic acid |
Common Name |
|
Symbol | |
Formula | C15H9I3O5 |
Exact Mass | 649.7584 |
Average Mass | 649.9432 |
SMILES | OC(=O)C(=O)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c2)c(I)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways