BMMCACENe003
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03175 |
KNApSAcK | |
CDX file | |
MOL file | BMMCACENe003.mol |
Shikimate 3-phosphate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3-Phospho-shikimic acid |
Common Name |
|
Symbol | |
Formula | C7H11O8P |
Exact Mass | 254.0191 |
Average Mass | 254.1312 |
SMILES | OC(=O)C(C1)=C[C@H]([C@@H](O)[C@H](O)1)OP(O)(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways