BMFYS6CAq003
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | ? |
| KEGG | C04349 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMFYS6CAq003.mol |
| (4S)-4,6-Dihydroxy-2,5-dioxohexanoate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (4S)-4,6-Dihydroxy-2,5-dioxo-hexanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C6H8O6 |
| Exact Mass | 176.032 |
| Average Mass | 176.1241 |
| SMILES | OCC(=O)[C@@H](O)CC(=O)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
