BMFYB5DAk014
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1948-82-9 |
KEGG | C05379 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB5DAk014.mol |
Oxalosuccinate | |
---|---|
Structural Information | |
Systematic Name | Oxalosuccinic acid |
Common Name |
|
Symbol | |
Formula | C6H6O7 |
Exact Mass | 190.0113 |
Average Mass | 190.1076 |
SMILES | OC(=O)CC(C(O)=O)C(=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways