BMFYB4DAr006
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C01088 |
KNApSAcK | |
CDX file | |
MOL file | BMFYB4DAr006.mol |
(R)-3,3-Dimethylmalate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (R)-3,3-Dimethyl-malic acid |
Common Name |
|
Symbol | |
Formula | C6H10O5 |
Exact Mass | 162.0528 |
Average Mass | 162.1406 |
SMILES | OC(=O)[C@H](O)C(C)(C)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways