BMCCPUAP0038
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1109-75-7 |
KEGG | C02741 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUAP0038.mol |
Phosphoribosyl-AMP | |
---|---|
Structural Information | |
Systematic Name | Phosphoribosyl-AMP |
Common Name |
|
Symbol | |
Formula | C15H24N5O14P2 |
Exact Mass | 560.0794 |
Average Mass | 560.3238 |
SMILES | O[C@@H]([C@@H](O)1)[C@@H](COP(O)(O)=O)O[C@H]1[n+1] |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways