BMCCPUADq017
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1637-39-4 |
KEGG | C00371 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPUADq017.mol |
Zeatin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Zeatin |
Common Name |
|
Symbol | |
Formula | C10H13N5O |
Exact Mass | 219.112 |
Average Mass | 219.2433 |
SMILES | OCC(C)=CCNc(n2)c(n1)c(nc2)nc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways