BMCCPTPTq015
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06313 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPTPTq015.mol |
Biopterin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Biopterin |
Common Name |
|
Symbol | |
Formula | C9H11N5O3 |
Exact Mass | 237.0861 |
Average Mass | 237.2155 |
SMILES | C[C@@H](O)[C@H](O)C(=C2)N=c(c(=O)1)c(N2)nc(N)n1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways