BMCCPTPTq001
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 1218-98-0 |
KEGG | C04874 |
KNApSAcK | |
CDX file | |
MOL file | BMCCPTPTq001.mol |
![]() | |
Structural Information | |
Systematic Name | 2-Amino-4-hydroxy-6-(D-erythro-1,2,3-trihydroxypropyl)-7,8-dihydro-pteridine |
Common Name | |
Symbol | |
Formula | C9H13N5O4 |
Exact Mass | 255.0967 |
Average Mass | 255.2308 |
SMILES | OC[C@@H](O)[C@@H](O)C(C2)=Nc(c(O)1)c(N2)nc(N)n1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways