BMCCNP--q011
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 59796-04-2 |
| KEGG | C01624 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCNP--q011.mol |
| Vermelone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Vermelone |
| Common Name |
|
| Symbol | |
| Formula | C10H10O3 |
| Exact Mass | 178.0629 |
| Average Mass | 178.1846 |
| SMILES | OC(C1)Cc(c2)c(c(O)cc2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
