BMCCID--o008
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63148-27-6 |
| KEGG | C03230 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCID--o008.mol |
| 3-Indoleglycolaldehyde | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Indole-glycolaldehyde |
| Common Name |
|
| Symbol | |
| Formula | C10H9NO2 |
| Exact Mass | 175.0633 |
| Average Mass | 175.184 |
| SMILES | O=CC(O)c(c1)c(c2)c(ccc2)n1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
