BMCCCC--p011
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 486-25-9 |
KEGG | C06712 |
KNApSAcK | |
CDX file | |
MOL file | BMCCCC--p011.mol |
Fluoren-9-one | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9-Fluorenone |
Common Name |
|
Symbol | |
Formula | C13H8O |
Exact Mass | 180.0575 |
Average Mass | 180.202 |
SMILES | O=C(c21)c(c3)c(ccc3)c(cccc2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways