BMAXS5CAr001
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 16804-57-2 |
KEGG | C00651 |
KNApSAcK | |
CDX file | |
MOL file | BMAXS5CAr001.mol |
![]() | |
Structural Information | |
Systematic Name | 4-Methylene-L-glutamic acid |
Common Name | |
Symbol | |
Formula | C6H9NO4 |
Exact Mass | 159.0531 |
Average Mass | 159.14 |
SMILES | C=C(C[C@H](N)C(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways