BMAAS4PH0001
From Metabolomics.JP
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03082 |
KNApSAcK | |
CDX file | |
MOL file | BMAAS4PH0001.mol |
4-Phospho-L-aspartate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | L-4-phospho-aspartic acid |
Common Name |
|
Symbol | |
Formula | C4H8NO7P |
Exact Mass | 213.0038 |
Average Mass | 213.0826 |
SMILES | N[C@@H](CC(=O)OP(O)(O)=O)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways