LBF22109SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0128 |
| LipidMaps | LMFA01030089 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF22109SC01.mol |
| cis-Erucic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-13-Docosenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C23H44O2 |
| Exact Mass | 352.334130652 |
| Average Mass | 352.59426 |
| SMILES | C(CCC(O)=O)CCCCCCCCC=CCCCCCCCCC |
| Physicochemical Information | |
| Melting Point | 34.7°C |
| Boiling Point | 281°C at 30 mmHg |
| Density | dX470 0.85321 |
| Optical Rotation | 1.44438 at 70°C |
| Reflactive Index | |
| Solubility | very soluble in ether and methylalchol <<0091>> <<0151>> <<0172>> <<0235>> <<0337>> |
| Spectral Information | |
| Mass Spectra | (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
