LBF20406SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0213 |
| LipidMaps | LMFA01030001 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406SC01.mol |
| Arachidonic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5, 8, 11, 14-Eicosatetraenoic acid / 5, 8, 11, 14-icosatetraenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | -49.5 °C |
| Boiling Point | 163 °C at 1 mmHg |
| Density | 0.9082 at 20 °C |
| Optical Rotation | 1.4824 at 20 °C |
| Reflactive Index | |
| Solubility | soluble in acetone, methyl alcohol, ether and petroleum ether.<<0224>><<0225>><<0328>><<0347>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
