LBF20406HO03
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA8085 |
| LipidMaps | LMFA03060040 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406HO03.mol |
| |
| Structural Information | |
| Systematic Name | 6-Hydroperoxy-4,8,11,14-Eicosatetraenoic Acid/6-Hydroperoxy-4,8,11,14-Eicosatetraenoate |
| Common Name | |
| Symbol | |
| Formula | C20H32O4 |
| Exact Mass | 336.23005951199997 |
| Average Mass | 336.46567999999996 |
| SMILES | C(CC=CCC=CCC=CCC(OO)C=CCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(Me-ester; after reduction and TMS)<<8098>>: m/e=406[M]; 316[M-HOTMS]; GC-EI-MS(Me-ester; after reduction and TBDMS)<<8098>>: m/e=448[M], 391[M-(CH3)3C], GC-EI-MS(Me-ester; after reduction, hydrogenation and TMS)<<8098/8099>>: m/e=399[M-CH3] |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
