LBF20406AM39
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | XPR7061 |
| LipidMaps | LMFA08020047 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM39.mol |
| |
| Structural Information | |
| Systematic Name | N- ( (R) - (-) -2-hydroxypropyl) alpha,alpha-dimethylarachidonoylamide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO2 |
| Exact Mass | 389.329379625 |
| Average Mass | 389.61446 |
| SMILES | CC(C)(C(=O)NC[C@@H](C)O)CCC=CCC=CCC=CCC=CCCCCC |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d 5.95 (br s, l H), 5.30-5.42 (m, 8H), 3.92-3.96 (m, 1H), 3.40-3.50 (m, 1H), 3.02-3.23 (m, 1H), 2.70-2.95 (m, 7H), 2.20-2.28(m, 1H), 2.00-2.15 (m, 4H), 1.70-1.75 (m, 2H), 1.20-1.52 (series of m, 14H), 0.89 (t, J=6.7 Hz, 3H), <<7001>> |
| Chromatograms | |
