LBF20404SC01
From Metabolomics.JP
| IDs and Links | |
|---|---|
| LipidBank | DFA0212 |
| LipidMaps | LMFA01030173 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20404SC01.mol |
| |
| Structural Information | |
| Systematic Name | 4, 8, 12, 16-Eicosatetraenoic acid / 4, 8, 12, 16-icosatetraenoic acid |
| Common Name | |
| Symbol | |
| Formula | C20H32O2 |
| Exact Mass | 304.240230268 |
| Average Mass | 304.46688 |
| SMILES | C(=CCCC=CCCC=CCCC=CCCC(O)=O)CCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 217 to 220 °C at 20 mmHg |
| Density | 0.9263 at 20 °C |
| Optical Rotation | 1.4915 at 20 °C |
| Reflactive Index | |
| Solubility | soluble in acetone, methyl alcohol, ether and petroleum ether.<<0442>><<0489>><<0496>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
